C27H42O7 — CID 54480040
2,2-diacetyloxy-4-[(3R)-3-[[(1R,2S)-2-[4-(3-methylcyclopentyl)butyl]-5-methylidenecyclopentyl]methyl]oxiran-2-yl]butanoic acid (PubChem CID 54480040) has the molecular formula C27H42O7 and a molecular weight of 478.63 g/mol. Its IUPAC name is 2,2-diacetyloxy-4-[(3R)-3-[[(1R,2S)-2-[4-(3-methylcyclopentyl)butyl]-5-methylidenecyclopentyl]methyl]oxiran-2-yl]butanoic acid.
| Compound Name | 2,2-diacetyloxy-4-[(3R)-3-[[(1R,2S)-2-[4-(3-methylcyclopentyl)butyl]-5-methylidenecyclopentyl]methyl]oxiran-2-yl]butanoic acid |
|---|---|
| PubChem CID | 54480040 |
| Molecular Formula | C27H42O7 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 2,2-diacetyloxy-4-[(3R)-3-[[(1R,2S)-2-[4-(3-methylcyclopentyl)butyl]-5-methylidenecyclopentyl]methyl]oxiran-2-yl]butanoic acid |
| SMILES | C=C1CC[C@H](CCCCC2CCC(C)C2)[C@H]1C[C@H]1OC1CCC(OC(C)=O)(OC(C)=O)C(=O)O |
| InChI | InChI=1S/C27H42O7/c1-17-9-11-21(15-17)7-5-6-8-22-12-10-18(2)23(22)16-25-24(32-25)13-14-27(26(30)31,33-19(3)28)34-20(4)29/h17,21-25H,2,5-16H2,1,3-4H3,(H,30,31)/t17?,21?,22-,23-,24?,25+/m0/s1 |
| InChIKey | XOIXKJZRCMOQJY-ZAISTPRUSA-N |
| XLogP | 5.41 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|