C16H22N2O4 — CID 54480255
ethyl N-[(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]carbamate (PubChem CID 54480255) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethyl N-[(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]carbamate.
| Compound Name | ethyl N-[(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 54480255 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | ethyl N-[(3-cyclopentyloxy-4-methoxyphenyl)methylideneamino]carbamate |
| SMILES | CCOC(=O)NN=Cc1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C16H22N2O4/c1-3-21-16(19)18-17-11-12-8-9-14(20-2)15(10-12)22-13-6-4-5-7-13/h8-11,13H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | XOMKQXTYVRXAEF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|