C24H27ClF3NO4S — CID 54480529
2-[3-chloro-4-[3-[[7-propyl-3-(3,3,3-trifluoropropyl)-1,2-benzoxazol-6-yl]oxy]propylsulfanyl]phenyl]ethane-1,1-diol (PubChem CID 54480529) has the molecular formula C24H27ClF3NO4S and a molecular weight of 518.00 g/mol. Its IUPAC name is 2-[3-chloro-4-[3-[[7-propyl-3-(3,3,3-trifluoropropyl)-1,2-benzoxazol-6-yl]oxy]propylsulfanyl]phenyl]ethane-1,1-diol.
| Compound Name | 2-[3-chloro-4-[3-[[7-propyl-3-(3,3,3-trifluoropropyl)-1,2-benzoxazol-6-yl]oxy]propylsulfanyl]phenyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 54480529 |
| Molecular Formula | C24H27ClF3NO4S |
| Molecular Weight | 518.00 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 2-[3-chloro-4-[3-[[7-propyl-3-(3,3,3-trifluoropropyl)-1,2-benzoxazol-6-yl]oxy]propylsulfanyl]phenyl]ethane-1,1-diol |
| SMILES | CCCc1c(OCCCSc2ccc(CC(O)O)cc2Cl)ccc2c(CCC(F)(F)F)noc12 |
| InChI | InChI=1S/C24H27ClF3NO4S/c1-2-4-17-20(7-6-16-19(29-33-23(16)17)9-10-24(26,27)28)32-11-3-12-34-21-8-5-15(13-18(21)25)14-22(30)31/h5-8,13,22,30-31H,2-4,9-12,14H2,1H3 |
| InChIKey | XORMGPDMMQCSOF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.00 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|