About N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide
N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide (PubChem CID 54480757) has the molecular formula C16H20N4OS
and a molecular weight of 316.43 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide |
| PubChem CID | 54480757 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide |
| SMILES | Cc1cn(C)c(=N/C(=N/c2ccccc2)N2CCOCC2)s1 |
| InChI | InChI=1S/C16H20N4OS/c1-13-12-19(2)16(22-13)18-15(20-8-10-21-11-9-20)17-14-6-4-3-5-7-14/h3-7,12H,8-11H2,1-2H3/b17-15-,18-16? |
| InChIKey | XOVJHRCBANMAIU-KDJWOMGKSA-N |
| XLogP | 2.32 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide?
The IUPAC name of N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide (CID 54480757) is N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide.
What is the SMILES notation for N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide?
The canonical SMILES for N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide is Cc1cn(C)c(=N/C(=N/c2ccccc2)N2CCOCC2)s1.
What is the InChIKey of N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide?
The InChIKey is XOVJHRCBANMAIU-KDJWOMGKSA-N. The full InChI is InChI=1S/C16H20N4OS/c1-13-12-19(2)16(22-13)18-15(20-8-10-21-11-9-20)17-14-6-4-3-5-7-14/h3-7,12H,8-11H2,1-2H3/b17-15-,18-16?.
What are the key properties of N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide?
N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide has a molecular weight of 316.43 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethyl-1,3-thiazol-2-ylidene)-N'-phenylmorpholine-4-carboximidamide is sourced from PubChem (CID 54480757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).