About 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one
3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one (PubChem CID 54480933) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one.
Molecular Properties
| Compound Name | 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one |
| PubChem CID | 54480933 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one |
| SMILES | CC1=C(C)C(=O)N(C(C)(C)C)CO1 |
| InChI | InChI=1S/C10H17NO2/c1-7-8(2)13-6-11(9(7)12)10(3,4)5/h6H2,1-5H3 |
| InChIKey | XOYIZQATCKKIID-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one?
The IUPAC name of 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one (CID 54480933) is 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one.
What is the SMILES notation for 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one?
The canonical SMILES for 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one is CC1=C(C)C(=O)N(C(C)(C)C)CO1.
What is the InChIKey of 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one?
The InChIKey is XOYIZQATCKKIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-7-8(2)13-6-11(9(7)12)10(3,4)5/h6H2,1-5H3.
What are the key properties of 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one?
3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one has a molecular weight of 183.25 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5,6-dimethyl-2H-1,3-oxazin-4-one is sourced from PubChem (CID 54480933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).