About diethyl 2-oxopropane-1,1-disulfonate
diethyl 2-oxopropane-1,1-disulfonate (PubChem CID 54481562) has the molecular formula C7H14O7S2
and a molecular weight of 274.32 g/mol. Its IUPAC name is diethyl 2-oxopropane-1,1-disulfonate.
Molecular Properties
| Compound Name | diethyl 2-oxopropane-1,1-disulfonate |
| PubChem CID | 54481562 |
| Molecular Formula | C7H14O7S2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | diethyl 2-oxopropane-1,1-disulfonate |
| SMILES | CCOS(=O)(=O)C(C(C)=O)S(=O)(=O)OCC |
| InChI | InChI=1S/C7H14O7S2/c1-4-13-15(9,10)7(6(3)8)16(11,12)14-5-2/h7H,4-5H2,1-3H3 |
| InChIKey | XPIKSXTXFBHMMJ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-oxopropane-1,1-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-oxopropane-1,1-disulfonate?
The IUPAC name of diethyl 2-oxopropane-1,1-disulfonate (CID 54481562) is diethyl 2-oxopropane-1,1-disulfonate.
What is the SMILES notation for diethyl 2-oxopropane-1,1-disulfonate?
The canonical SMILES for diethyl 2-oxopropane-1,1-disulfonate is CCOS(=O)(=O)C(C(C)=O)S(=O)(=O)OCC.
What is the InChIKey of diethyl 2-oxopropane-1,1-disulfonate?
The InChIKey is XPIKSXTXFBHMMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O7S2/c1-4-13-15(9,10)7(6(3)8)16(11,12)14-5-2/h7H,4-5H2,1-3H3.
What are the key properties of diethyl 2-oxopropane-1,1-disulfonate?
diethyl 2-oxopropane-1,1-disulfonate has a molecular weight of 274.32 g/mol, XLogP of -0.37, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-oxopropane-1,1-disulfonate is sourced from PubChem (CID 54481562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).