C20H18F3NO2 — CID 54482047
9-[3-(trifluoromethyl)phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione (PubChem CID 54482047) has the molecular formula C20H18F3NO2 and a molecular weight of 361.36 g/mol. Its IUPAC name is 9-[3-(trifluoromethyl)phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione.
| Compound Name | 9-[3-(trifluoromethyl)phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 54482047 |
| Molecular Formula | C20H18F3NO2 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 9-[3-(trifluoromethyl)phenyl]-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1cccc(C(F)(F)F)c1)C1C(=O)CCCC1=N2 |
| InChI | InChI=1S/C20H18F3NO2/c21-20(22,23)12-5-1-4-11(10-12)17-18-13(6-2-8-15(18)25)24-14-7-3-9-16(26)19(14)17/h1,4-5,10,17-18H,2-3,6-9H2 |
| InChIKey | XPRGAFRTRHLFEX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |