C32H54O8 — CID 54482100
7-[(1R,2R,3R)-2-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-3-hydroxyheptanoic acid (PubChem CID 54482100) has the molecular formula C32H54O8 and a molecular weight of 566.78 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-3-hydroxyheptanoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-3-hydroxyheptanoic acid |
|---|---|
| PubChem CID | 54482100 |
| Molecular Formula | C32H54O8 |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-3-hydroxyheptanoic acid |
| SMILES | CCCCC(C)(C)[C@@H](C=C[C@H]1[C@H](OC2CCCCO2)CC(=O)[C@@H]1CCCCC(O)CC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C32H54O8/c1-4-5-18-32(2,3)28(40-31-15-9-11-20-38-31)17-16-25-24(13-7-6-12-23(33)21-29(35)36)26(34)22-27(25)39-30-14-8-10-19-37-30/h16-17,23-25,27-28,30-31,33H,4-15,18-22H2,1-3H3,(H,35,36)/t23?,24-,25-,27-,28-,30?,31?/m1/s1 |
| InChIKey | XPSGEGHICLMPCS-VIXPZJLPSA-N |
| XLogP | 6.18 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|