C18H17Cl2N3O3 — CID 54482143
(2S,4R)-4-(N-acetyl-4-aminoanilino)-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid (PubChem CID 54482143) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is (2S,4R)-4-(N-acetyl-4-aminoanilino)-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | (2S,4R)-4-(N-acetyl-4-aminoanilino)-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 54482143 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (2S,4R)-4-(N-acetyl-4-aminoanilino)-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
| SMILES | CC(=O)N(c1ccc(N)cc1)[C@@H]1C[C@@H](C(=O)O)Nc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C18H17Cl2N3O3/c1-9(24)23(12-4-2-11(21)3-5-12)16-8-15(18(25)26)22-14-7-10(19)6-13(20)17(14)16/h2-7,15-16,22H,8,21H2,1H3,(H,25,26)/t15-,16+/m0/s1 |
| InChIKey | XPTCIEMSDIKWPS-JKSUJKDBSA-N |
| XLogP | 3.94 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|