About tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane
tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane (PubChem CID 54482166) has the molecular formula C27H45BN6
and a molecular weight of 464.51 g/mol. Its IUPAC name is tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane.
Molecular Properties
| Compound Name | tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane |
| PubChem CID | 54482166 |
| Molecular Formula | C27H45BN6 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.38 |
| IUPAC Name | tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane |
| SMILES | CC(C)c1n[nH]c(C(C)C)c1B(c1c(C(C)C)n[nH]c1C(C)C)c1c(C(C)C)n[nH]c1C(C)C |
| InChI | InChI=1S/C27H45BN6/c1-13(2)22-19(23(14(3)4)30-29-22)28(20-24(15(5)6)31-32-25(20)16(7)8)21-26(17(9)10)33-34-27(21)18(11)12/h13-18H,1-12H3,(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | XPTMNGFXGLJQNY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane?
The IUPAC name of tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane (CID 54482166) is tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane.
What is the SMILES notation for tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane?
The canonical SMILES for tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane is CC(C)c1n[nH]c(C(C)C)c1B(c1c(C(C)C)n[nH]c1C(C)C)c1c(C(C)C)n[nH]c1C(C)C.
What is the InChIKey of tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane?
The InChIKey is XPTMNGFXGLJQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H45BN6/c1-13(2)22-19(23(14(3)4)30-29-22)28(20-24(15(5)6)31-32-25(20)16(7)8)21-26(17(9)10)33-34-27(21)18(11)12/h13-18H,1-12H3,(H,29,30)(H,31,32)(H,33,34).
What are the key properties of tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane?
tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane has a molecular weight of 464.51 g/mol, XLogP of 5.11, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]borane is sourced from PubChem (CID 54482166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).