About 2-amino-3,4-diethylbenzaldehyde
2-amino-3,4-diethylbenzaldehyde (PubChem CID 54482978) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-amino-3,4-diethylbenzaldehyde.
Molecular Properties
| Compound Name | 2-amino-3,4-diethylbenzaldehyde |
| PubChem CID | 54482978 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-amino-3,4-diethylbenzaldehyde |
| SMILES | CCc1ccc(C=O)c(N)c1CC |
| InChI | InChI=1S/C11H15NO/c1-3-8-5-6-9(7-13)11(12)10(8)4-2/h5-7H,3-4,12H2,1-2H3 |
| InChIKey | XQHYECQMLZJNSI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,4-diethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,4-diethylbenzaldehyde?
The IUPAC name of 2-amino-3,4-diethylbenzaldehyde (CID 54482978) is 2-amino-3,4-diethylbenzaldehyde.
What is the SMILES notation for 2-amino-3,4-diethylbenzaldehyde?
The canonical SMILES for 2-amino-3,4-diethylbenzaldehyde is CCc1ccc(C=O)c(N)c1CC.
What is the InChIKey of 2-amino-3,4-diethylbenzaldehyde?
The InChIKey is XQHYECQMLZJNSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-3-8-5-6-9(7-13)11(12)10(8)4-2/h5-7H,3-4,12H2,1-2H3.
What are the key properties of 2-amino-3,4-diethylbenzaldehyde?
2-amino-3,4-diethylbenzaldehyde has a molecular weight of 177.25 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,4-diethylbenzaldehyde is sourced from PubChem (CID 54482978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).