C22H24Cl2F3N5O6S — CID 54483030
(2S)-5-(diaminomethylideneamino)-2-[[(3,4-dichlorophenyl)methylamino]-[2-[4-(trifluoromethoxy)phenyl]sulfonylacetyl]amino]pentanoic acid (PubChem CID 54483030) has the molecular formula C22H24Cl2F3N5O6S and a molecular weight of 614.43 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(3,4-dichlorophenyl)methylamino]-[2-[4-(trifluoromethoxy)phenyl]sulfonylacetyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(3,4-dichlorophenyl)methylamino]-[2-[4-(trifluoromethoxy)phenyl]sulfonylacetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 54483030 |
| Molecular Formula | C22H24Cl2F3N5O6S |
| Molecular Weight | 614.43 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(3,4-dichlorophenyl)methylamino]-[2-[4-(trifluoromethoxy)phenyl]sulfonylacetyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@@H](C(=O)O)N(NCc1ccc(Cl)c(Cl)c1)C(=O)CS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H24Cl2F3N5O6S/c23-16-8-3-13(10-17(16)24)11-31-32(18(20(34)35)2-1-9-30-21(28)29)19(33)12-39(36,37)15-6-4-14(5-7-15)38-22(25,26)27/h3-8,10,18,31H,1-2,9,11-12H2,(H,34,35)(H4,28,29,30)/t18-/m0/s1 |
| InChIKey | XQIVJHARGKFELR-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 177.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|