C13H24O7S — CID 54483244
methyl 6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylhexanoate (PubChem CID 54483244) has the molecular formula C13H24O7S and a molecular weight of 324.40 g/mol. Its IUPAC name is methyl 6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 54483244 |
| Molecular Formula | C13H24O7S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | methyl 6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylhexanoate |
| SMILES | COC(=O)CCCCCS[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H24O7S/c1-19-9(15)5-3-2-4-6-21-13-12(18)11(17)10(16)8(7-14)20-13/h8,10-14,16-18H,2-7H2,1H3/t8-,10-,11+,12-,13+/m1/s1 |
| InChIKey | XQMQNIFHGDKWSY-ZMHPAJMFSA-N |
| XLogP | -0.75 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|