C24H31ClN2O4S — CID 54483465
diethyl 4-(3-chlorophenyl)-2-methyl-6-[2-(propan-2-ylamino)ethylsulfanylmethyl]pyridine-3,5-dicarboxylate (PubChem CID 54483465) has the molecular formula C24H31ClN2O4S and a molecular weight of 479.04 g/mol. Its IUPAC name is diethyl 4-(3-chlorophenyl)-2-methyl-6-[2-(propan-2-ylamino)ethylsulfanylmethyl]pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(3-chlorophenyl)-2-methyl-6-[2-(propan-2-ylamino)ethylsulfanylmethyl]pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54483465 |
| Molecular Formula | C24H31ClN2O4S |
| Molecular Weight | 479.04 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | diethyl 4-(3-chlorophenyl)-2-methyl-6-[2-(propan-2-ylamino)ethylsulfanylmethyl]pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)nc(CSCCNC(C)C)c(C(=O)OCC)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H31ClN2O4S/c1-6-30-23(28)20-16(5)27-19(14-32-12-11-26-15(3)4)22(24(29)31-7-2)21(20)17-9-8-10-18(25)13-17/h8-10,13,15,26H,6-7,11-12,14H2,1-5H3 |
| InChIKey | XQQRUZKITAVECS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.04 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|