About (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate
(4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate (PubChem CID 54483521) has the molecular formula C16H12F3N3S
and a molecular weight of 335.35 g/mol. Its IUPAC name is (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate.
Molecular Properties
| Compound Name | (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate |
| PubChem CID | 54483521 |
| Molecular Formula | C16H12F3N3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate |
| SMILES | [H]/N=C(\Sc1ccc(N)cc1)C(C#N)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3N3S/c17-16(18,19)14-4-2-1-3-12(14)13(9-20)15(22)23-11-7-5-10(21)6-8-11/h1-8,13,22H,21H2/b22-15- |
| InChIKey | XQRVCODIGHFXKQ-JCMHNJIXSA-N |
| XLogP | 4.66 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate?
The IUPAC name of (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate (CID 54483521) is (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate.
What is the SMILES notation for (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate?
The canonical SMILES for (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate is [H]/N=C(\Sc1ccc(N)cc1)C(C#N)c1ccccc1C(F)(F)F.
What is the InChIKey of (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate?
The InChIKey is XQRVCODIGHFXKQ-JCMHNJIXSA-N. The full InChI is InChI=1S/C16H12F3N3S/c17-16(18,19)14-4-2-1-3-12(14)13(9-20)15(22)23-11-7-5-10(21)6-8-11/h1-8,13,22H,21H2/b22-15-.
What are the key properties of (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate?
(4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate has a molecular weight of 335.35 g/mol, XLogP of 4.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) 2-cyano-2-[2-(trifluoromethyl)phenyl]ethanimidothioate is sourced from PubChem (CID 54483521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).