About 2-amino-1-methyl-4,5-dihydropyrimidin-6-one
2-amino-1-methyl-4,5-dihydropyrimidin-6-one (PubChem CID 54484269) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is 2-amino-1-methyl-4,5-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 2-amino-1-methyl-4,5-dihydropyrimidin-6-one |
| PubChem CID | 54484269 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 2-amino-1-methyl-4,5-dihydropyrimidin-6-one |
| SMILES | CN1C(=O)CCN=C1N |
| InChI | InChI=1S/C5H9N3O/c1-8-4(9)2-3-7-5(8)6/h2-3H2,1H3,(H2,6,7) |
| InChIKey | XRENFCMQJUPAGO-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-methyl-4,5-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-methyl-4,5-dihydropyrimidin-6-one?
The IUPAC name of 2-amino-1-methyl-4,5-dihydropyrimidin-6-one (CID 54484269) is 2-amino-1-methyl-4,5-dihydropyrimidin-6-one.
What is the SMILES notation for 2-amino-1-methyl-4,5-dihydropyrimidin-6-one?
The canonical SMILES for 2-amino-1-methyl-4,5-dihydropyrimidin-6-one is CN1C(=O)CCN=C1N.
What is the InChIKey of 2-amino-1-methyl-4,5-dihydropyrimidin-6-one?
The InChIKey is XRENFCMQJUPAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-8-4(9)2-3-7-5(8)6/h2-3H2,1H3,(H2,6,7).
What are the key properties of 2-amino-1-methyl-4,5-dihydropyrimidin-6-one?
2-amino-1-methyl-4,5-dihydropyrimidin-6-one has a molecular weight of 127.15 g/mol, XLogP of -0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-methyl-4,5-dihydropyrimidin-6-one is sourced from PubChem (CID 54484269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).