C26H46O8 — CID 54484337
4-hexoxy-5-hexyl-2-oxoundecane-2,3,4-tricarboxylic acid (PubChem CID 54484337) has the molecular formula C26H46O8 and a molecular weight of 486.65 g/mol. Its IUPAC name is 4-hexoxy-5-hexyl-2-oxoundecane-2,3,4-tricarboxylic acid.
| Compound Name | 4-hexoxy-5-hexyl-2-oxoundecane-2,3,4-tricarboxylic acid |
|---|---|
| PubChem CID | 54484337 |
| Molecular Formula | C26H46O8 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | 4-hexoxy-5-hexyl-2-oxoundecane-2,3,4-tricarboxylic acid |
| SMILES | CCCCCCOC(C(=O)O)(C(C(C)=O)C(=O)O)C(CCCCCC)(CCCCCC)C(=O)O |
| InChI | InChI=1S/C26H46O8/c1-5-8-11-14-17-25(23(30)31,18-15-12-9-6-2)26(24(32)33,21(20(4)27)22(28)29)34-19-16-13-10-7-3/h21H,5-19H2,1-4H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | XRFVYCPAYSXCAZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|