About 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide
1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide (PubChem CID 54484374) has the molecular formula C27H48Cl2N2O2
and a molecular weight of 503.60 g/mol. Its IUPAC name is 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide |
| PubChem CID | 54484374 |
| Molecular Formula | C27H48Cl2N2O2 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide |
| SMILES | CCCCCCCCC(Cl)C(Cl)CCCCCCCCOCN1C=CC=C(C(=O)NCC)C1 |
| InChI | InChI=1S/C27H48Cl2N2O2/c1-3-5-6-7-10-13-18-25(28)26(29)19-14-11-8-9-12-15-21-33-23-31-20-16-17-24(22-31)27(32)30-4-2/h16-17,20,25-26H,3-15,18-19,21-23H2,1-2H3,(H,30,32) |
| InChIKey | XRGPVUMDBASJGC-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide?
The IUPAC name of 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide (CID 54484374) is 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide.
What is the SMILES notation for 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide?
The canonical SMILES for 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide is CCCCCCCCC(Cl)C(Cl)CCCCCCCCOCN1C=CC=C(C(=O)NCC)C1.
What is the InChIKey of 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide?
The InChIKey is XRGPVUMDBASJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H48Cl2N2O2/c1-3-5-6-7-10-13-18-25(28)26(29)19-14-11-8-9-12-15-21-33-23-31-20-16-17-24(22-31)27(32)30-4-2/h16-17,20,25-26H,3-15,18-19,21-23H2,1-2H3,(H,30,32).
What are the key properties of 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide?
1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide has a molecular weight of 503.60 g/mol, XLogP of 7.55, 21 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9,10-dichlorooctadecoxymethyl)-N-ethyl-2H-pyridine-3-carboxamide is sourced from PubChem (CID 54484374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).