About N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide
N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide (PubChem CID 54484386) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide |
| PubChem CID | 54484386 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCN1C(C)COCC1C |
| InChI | InChI=1S/C11H20N2O2/c1-4-11(14)12-5-6-13-9(2)7-15-8-10(13)3/h4,9-10H,1,5-8H2,2-3H3,(H,12,14) |
| InChIKey | XRGVYRYJSVVHCM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide?
The IUPAC name of N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide (CID 54484386) is N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide.
What is the SMILES notation for N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide?
The canonical SMILES for N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide is C=CC(=O)NCCN1C(C)COCC1C.
What is the InChIKey of N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide?
The InChIKey is XRGVYRYJSVVHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-4-11(14)12-5-6-13-9(2)7-15-8-10(13)3/h4,9-10H,1,5-8H2,2-3H3,(H,12,14).
What are the key properties of N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide?
N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide has a molecular weight of 212.29 g/mol, XLogP of 0.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide is sourced from PubChem (CID 54484386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).