C4Cl2F6 — CID 54484509
1,2-dichloro-1,3,3,4,4,4-hexafluorobut-1-ene (PubChem CID 54484509) has the molecular formula C4Cl2F6 and a molecular weight of 232.94 g/mol. Its IUPAC name is 1,2-dichloro-1,3,3,4,4,4-hexafluorobut-1-ene.
| Compound Name | 1,2-dichloro-1,3,3,4,4,4-hexafluorobut-1-ene |
|---|---|
| PubChem CID | 54484509 |
| Molecular Formula | C4Cl2F6 |
| Molecular Weight | 232.94 g/mol |
| Exact Mass | 231.93 |
| IUPAC Name | 1,2-dichloro-1,3,3,4,4,4-hexafluorobut-1-ene |
| SMILES | FC(Cl)=C(Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4Cl2F6/c5-1(2(6)7)3(8,9)4(10,11)12 |
| InChIKey | XRIZIELNBJXZRQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|