C18H20F16I2Si2 — CID 54484558
(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluoro-1,12-diiodo-12-trimethylsilyldodeca-1,11-dienyl)-trimethylsilane (PubChem CID 54484558) has the molecular formula C18H20F16I2Si2 and a molecular weight of 850.31 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluoro-1,12-diiodo-12-trimethylsilyldodeca-1,11-dienyl)-trimethylsilane.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluoro-1,12-diiodo-12-trimethylsilyldodeca-1,11-dienyl)-trimethylsilane |
|---|---|
| PubChem CID | 54484558 |
| Molecular Formula | C18H20F16I2Si2 |
| Molecular Weight | 850.31 g/mol |
| Exact Mass | 849.89 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluoro-1,12-diiodo-12-trimethylsilyldodeca-1,11-dienyl)-trimethylsilane |
| SMILES | C[Si](C)(C)C(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C(I)[Si](C)(C)C |
| InChI | InChI=1S/C18H20F16I2Si2/c1-37(2,3)9(35)7-11(19,20)13(23,24)15(27,28)17(31,32)18(33,34)16(29,30)14(25,26)12(21,22)8-10(36)38(4,5)6/h7-8H,1-6H3 |
| InChIKey | XRJVWVVYOOBJEO-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.31 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|