C38H16F6O8 — CID 54484864
14,18-diphenyl-14,18-bis(trifluoromethyl)-4,9,23,28-tetraoxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1(17),2,5(13),6,11,15,19(27),20,25-nonaene-8,10,22,24-tetrone (PubChem CID 54484864) has the molecular formula C38H16F6O8 and a molecular weight of 714.53 g/mol. Its IUPAC name is 14,18-diphenyl-14,18-bis(trifluoromethyl)-4,9,23,28-tetraoxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1(17),2,5(13),6,11,15,19(27),20,25-nonaene-8,10,22,24-tetrone.
| Compound Name | 14,18-diphenyl-14,18-bis(trifluoromethyl)-4,9,23,28-tetraoxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1(17),2,5(13),6,11,15,19(27),20,25-nonaene-8,10,22,24-tetrone |
|---|---|
| PubChem CID | 54484864 |
| Molecular Formula | C38H16F6O8 |
| Molecular Weight | 714.53 g/mol |
| Exact Mass | 714.07 |
| IUPAC Name | 14,18-diphenyl-14,18-bis(trifluoromethyl)-4,9,23,28-tetraoxaheptacyclo[15.11.0.03,15.05,13.07,11.019,27.021,25]octacosa-1(17),2,5(13),6,11,15,19(27),20,25-nonaene-8,10,22,24-tetrone |
| SMILES | O=C1OC(=O)c2cc3c(cc21)Oc1cc2c(cc1C3(c1ccccc1)C(F)(F)F)C(c1ccccc1)(C(F)(F)F)c1cc3c(cc1O2)C(=O)OC3=O |
| InChI | InChI=1S/C38H16F6O8/c39-37(40,41)35(17-7-3-1-4-8-17)23-11-19-21(33(47)51-31(19)45)13-27(23)49-29-16-30-26(15-25(29)35)36(38(42,43)44,18-9-5-2-6-10-18)24-12-20-22(14-28(24)50-30)34(48)52-32(20)46/h1-16H |
| InChIKey | XRPDPRVFUVWHHH-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.53 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|