C13H13FOS2 — CID 54484874
4-(1,3-dithian-2-ylidene)-6-fluoro-2,3-dihydrochromene (PubChem CID 54484874) has the molecular formula C13H13FOS2 and a molecular weight of 268.38 g/mol. Its IUPAC name is 4-(1,3-dithian-2-ylidene)-6-fluoro-2,3-dihydrochromene.
| Compound Name | 4-(1,3-dithian-2-ylidene)-6-fluoro-2,3-dihydrochromene |
|---|---|
| PubChem CID | 54484874 |
| Molecular Formula | C13H13FOS2 |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 4-(1,3-dithian-2-ylidene)-6-fluoro-2,3-dihydrochromene |
| SMILES | Fc1ccc2c(c1)C(=C1SCCCS1)CCO2 |
| InChI | InChI=1S/C13H13FOS2/c14-9-2-3-12-11(8-9)10(4-5-15-12)13-16-6-1-7-17-13/h2-3,8H,1,4-7H2 |
| InChIKey | XRPHYHIVDMTZNR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |