C30H36N4O2 — CID 54485022
N-(morpholin-4-ylmethyl)naphthalen-1-amine;N-(morpholin-4-ylmethyl)naphthalen-2-amine (PubChem CID 54485022) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-(morpholin-4-ylmethyl)naphthalen-1-amine;N-(morpholin-4-ylmethyl)naphthalen-2-amine.
| Compound Name | N-(morpholin-4-ylmethyl)naphthalen-1-amine;N-(morpholin-4-ylmethyl)naphthalen-2-amine |
|---|---|
| PubChem CID | 54485022 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | N-(morpholin-4-ylmethyl)naphthalen-1-amine;N-(morpholin-4-ylmethyl)naphthalen-2-amine |
| SMILES | c1ccc2c(NCN3CCOCC3)cccc2c1.c1ccc2cc(NCN3CCOCC3)ccc2c1 |
| InChI | InChI=1S/2C15H18N2O/c1-2-6-14-13(4-1)5-3-7-15(14)16-12-17-8-10-18-11-9-17;1-2-4-14-11-15(6-5-13(14)3-1)16-12-17-7-9-18-10-8-17/h1-7,16H,8-12H2;1-6,11,16H,7-10,12H2 |
| InChIKey | XRRRBNQHAVLPND-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |