About 2-chloro-1,3-benzothiazole-4-sulfonyl chloride
2-chloro-1,3-benzothiazole-4-sulfonyl chloride (PubChem CID 54485520) has the molecular formula C7H3Cl2NO2S2
and a molecular weight of 268.15 g/mol. Its IUPAC name is 2-chloro-1,3-benzothiazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-chloro-1,3-benzothiazole-4-sulfonyl chloride |
| PubChem CID | 54485520 |
| Molecular Formula | C7H3Cl2NO2S2 |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 266.90 |
| IUPAC Name | 2-chloro-1,3-benzothiazole-4-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cccc2sc(Cl)nc12 |
| InChI | InChI=1S/C7H3Cl2NO2S2/c8-7-10-6-4(13-7)2-1-3-5(6)14(9,11)12/h1-3H |
| InChIKey | XSABGBKSSJWSNB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-1,3-benzothiazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-benzothiazole-4-sulfonyl chloride?
The IUPAC name of 2-chloro-1,3-benzothiazole-4-sulfonyl chloride (CID 54485520) is 2-chloro-1,3-benzothiazole-4-sulfonyl chloride.
What is the SMILES notation for 2-chloro-1,3-benzothiazole-4-sulfonyl chloride?
The canonical SMILES for 2-chloro-1,3-benzothiazole-4-sulfonyl chloride is O=S(=O)(Cl)c1cccc2sc(Cl)nc12.
What is the InChIKey of 2-chloro-1,3-benzothiazole-4-sulfonyl chloride?
The InChIKey is XSABGBKSSJWSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2NO2S2/c8-7-10-6-4(13-7)2-1-3-5(6)14(9,11)12/h1-3H.
What are the key properties of 2-chloro-1,3-benzothiazole-4-sulfonyl chloride?
2-chloro-1,3-benzothiazole-4-sulfonyl chloride has a molecular weight of 268.15 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-benzothiazole-4-sulfonyl chloride is sourced from PubChem (CID 54485520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).