C23H29FN2O2S — CID 54486142
4-fluoro-1-hydroxy-1-phenyl-4-[4-(3-phenylsulfanylpropyl)piperazin-1-yl]butan-2-one (PubChem CID 54486142) has the molecular formula C23H29FN2O2S and a molecular weight of 416.56 g/mol. Its IUPAC name is 4-fluoro-1-hydroxy-1-phenyl-4-[4-(3-phenylsulfanylpropyl)piperazin-1-yl]butan-2-one.
| Compound Name | 4-fluoro-1-hydroxy-1-phenyl-4-[4-(3-phenylsulfanylpropyl)piperazin-1-yl]butan-2-one |
|---|---|
| PubChem CID | 54486142 |
| Molecular Formula | C23H29FN2O2S |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 4-fluoro-1-hydroxy-1-phenyl-4-[4-(3-phenylsulfanylpropyl)piperazin-1-yl]butan-2-one |
| SMILES | O=C(CC(F)N1CCN(CCCSc2ccccc2)CC1)C(O)c1ccccc1 |
| InChI | InChI=1S/C23H29FN2O2S/c24-22(18-21(27)23(28)19-8-3-1-4-9-19)26-15-13-25(14-16-26)12-7-17-29-20-10-5-2-6-11-20/h1-6,8-11,22-23,28H,7,12-18H2 |
| InChIKey | XSLBZRBQSBJFJD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|