C20H29NO4 — CID 54486368
methyl 1-[[2-(4-methoxy-2-methylphenyl)acetyl]amino]cyclooctane-1-carboxylate (PubChem CID 54486368) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is methyl 1-[[2-(4-methoxy-2-methylphenyl)acetyl]amino]cyclooctane-1-carboxylate.
| Compound Name | methyl 1-[[2-(4-methoxy-2-methylphenyl)acetyl]amino]cyclooctane-1-carboxylate |
|---|---|
| PubChem CID | 54486368 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | methyl 1-[[2-(4-methoxy-2-methylphenyl)acetyl]amino]cyclooctane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)Cc2ccc(OC)cc2C)CCCCCCC1 |
| InChI | InChI=1S/C20H29NO4/c1-15-13-17(24-2)10-9-16(15)14-18(22)21-20(19(23)25-3)11-7-5-4-6-8-12-20/h9-10,13H,4-8,11-12,14H2,1-3H3,(H,21,22) |
| InChIKey | XSPHRRFGBBQILO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |