C8H12N2O6 — CID 54486402
(3S)-4-[[(1S)-1-carboxyethyl]amino]-3-formamido-4-oxobutanoic acid (PubChem CID 54486402) has the molecular formula C8H12N2O6 and a molecular weight of 232.19 g/mol. Its IUPAC name is (3S)-4-[[(1S)-1-carboxyethyl]amino]-3-formamido-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(1S)-1-carboxyethyl]amino]-3-formamido-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54486402 |
| Molecular Formula | C8H12N2O6 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (3S)-4-[[(1S)-1-carboxyethyl]amino]-3-formamido-4-oxobutanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](CC(=O)O)NC=O)C(=O)O |
| InChI | InChI=1S/C8H12N2O6/c1-4(8(15)16)10-7(14)5(9-3-11)2-6(12)13/h3-5H,2H2,1H3,(H,9,11)(H,10,14)(H,12,13)(H,15,16)/t4-,5-/m0/s1 |
| InChIKey | XSPVNPNWMIQCQH-WHFBIAKZSA-N |
| XLogP | -1.84 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|