C10H20N2O — CID 54486464
N,2-dimethyl-N-[4-(methylamino)butyl]prop-2-enamide (PubChem CID 54486464) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N,2-dimethyl-N-[4-(methylamino)butyl]prop-2-enamide.
| Compound Name | N,2-dimethyl-N-[4-(methylamino)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 54486464 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N,2-dimethyl-N-[4-(methylamino)butyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCCCNC |
| InChI | InChI=1S/C10H20N2O/c1-9(2)10(13)12(4)8-6-5-7-11-3/h11H,1,5-8H2,2-4H3 |
| InChIKey | XSQVKIKIONKFLK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|