C38H22F6O3 — CID 54486597
1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 54486597) has the molecular formula C38H22F6O3 and a molecular weight of 640.58 g/mol. Its IUPAC name is 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 54486597 |
| Molecular Formula | C38H22F6O3 |
| Molecular Weight | 640.58 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)c1ccc2c(c1)C(c1ccc(OC(F)=C(F)F)cc1)(c1ccc(OC(F)=C(F)F)cc1)c1ccccc1-2 |
| InChI | InChI=1S/C38H22F6O3/c39-34(40)36(43)46-27-16-12-25(13-17-27)38(26-14-18-28(19-15-26)47-37(44)35(41)42)31-9-5-4-8-29(31)30-20-11-24(22-32(30)38)33(45)21-10-23-6-2-1-3-7-23/h1-22H |
| InChIKey | XSTDUZHVWDINQX-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.58 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|