C15H14F2O — CID 54486908
2,4-difluoro-1-(2-propan-2-ylphenoxy)benzene (PubChem CID 54486908) has the molecular formula C15H14F2O and a molecular weight of 248.27 g/mol. Its IUPAC name is 2,4-difluoro-1-(2-propan-2-ylphenoxy)benzene.
| Compound Name | 2,4-difluoro-1-(2-propan-2-ylphenoxy)benzene |
|---|---|
| PubChem CID | 54486908 |
| Molecular Formula | C15H14F2O |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2,4-difluoro-1-(2-propan-2-ylphenoxy)benzene |
| SMILES | CC(C)c1ccccc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C15H14F2O/c1-10(2)12-5-3-4-6-14(12)18-15-8-7-11(16)9-13(15)17/h3-10H,1-2H3 |
| InChIKey | IEYWPWAVGYNSMI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |