C15H17F3N2OS — CID 54486985
N-pyrrolidin-3-yl-N-[4-(trifluoromethylsulfanyl)phenyl]but-2-enamide (PubChem CID 54486985) has the molecular formula C15H17F3N2OS and a molecular weight of 330.38 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-N-[4-(trifluoromethylsulfanyl)phenyl]but-2-enamide.
| Compound Name | N-pyrrolidin-3-yl-N-[4-(trifluoromethylsulfanyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 54486985 |
| Molecular Formula | C15H17F3N2OS |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-pyrrolidin-3-yl-N-[4-(trifluoromethylsulfanyl)phenyl]but-2-enamide |
| SMILES | CC=CC(=O)N(c1ccc(SC(F)(F)F)cc1)C1CCNC1 |
| InChI | InChI=1S/C15H17F3N2OS/c1-2-3-14(21)20(12-8-9-19-10-12)11-4-6-13(7-5-11)22-15(16,17)18/h2-7,12,19H,8-10H2,1H3 |
| InChIKey | XSZUYGMHSZNIJQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|