About 6-ethoxyhexyl 5-sulfanylpentanoate
6-ethoxyhexyl 5-sulfanylpentanoate (PubChem CID 54486992) has the molecular formula C13H26O3S
and a molecular weight of 262.41 g/mol. Its IUPAC name is 6-ethoxyhexyl 5-sulfanylpentanoate.
Molecular Properties
| Compound Name | 6-ethoxyhexyl 5-sulfanylpentanoate |
| PubChem CID | 54486992 |
| Molecular Formula | C13H26O3S |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 6-ethoxyhexyl 5-sulfanylpentanoate |
| SMILES | CCOCCCCCCOC(=O)CCCCS |
| InChI | InChI=1S/C13H26O3S/c1-2-15-10-6-3-4-7-11-16-13(14)9-5-8-12-17/h17H,2-12H2,1H3 |
| InChIKey | XSZXSUGTCJCIBR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxyhexyl 5-sulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxyhexyl 5-sulfanylpentanoate?
The IUPAC name of 6-ethoxyhexyl 5-sulfanylpentanoate (CID 54486992) is 6-ethoxyhexyl 5-sulfanylpentanoate.
What is the SMILES notation for 6-ethoxyhexyl 5-sulfanylpentanoate?
The canonical SMILES for 6-ethoxyhexyl 5-sulfanylpentanoate is CCOCCCCCCOC(=O)CCCCS.
What is the InChIKey of 6-ethoxyhexyl 5-sulfanylpentanoate?
The InChIKey is XSZXSUGTCJCIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3S/c1-2-15-10-6-3-4-7-11-16-13(14)9-5-8-12-17/h17H,2-12H2,1H3.
What are the key properties of 6-ethoxyhexyl 5-sulfanylpentanoate?
6-ethoxyhexyl 5-sulfanylpentanoate has a molecular weight of 262.41 g/mol, XLogP of 3.23, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxyhexyl 5-sulfanylpentanoate is sourced from PubChem (CID 54486992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).