About ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate
ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate (PubChem CID 54487124) has the molecular formula C20H31N3O4
and a molecular weight of 377.49 g/mol. Its IUPAC name is ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate |
| PubChem CID | 54487124 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(=O)OC(C)(C)C)CCCN1CC=Cc1cnc[nH]1 |
| InChI | InChI=1S/C20H31N3O4/c1-18(2,3)26-16(24)20(17(25)27-19(4,5)6)10-8-12-23(20)11-7-9-15-13-21-14-22-15/h7,9,13-14H,8,10-12H2,1-6H3,(H,21,22) |
| InChIKey | XTCLPBKWYZHWGW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate?
The IUPAC name of ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate (CID 54487124) is ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate.
What is the SMILES notation for ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate?
The canonical SMILES for ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate is CC(C)(C)OC(=O)C1(C(=O)OC(C)(C)C)CCCN1CC=Cc1cnc[nH]1.
What is the InChIKey of ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate?
The InChIKey is XTCLPBKWYZHWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N3O4/c1-18(2,3)26-16(24)20(17(25)27-19(4,5)6)10-8-12-23(20)11-7-9-15-13-21-14-22-15/h7,9,13-14H,8,10-12H2,1-6H3,(H,21,22).
What are the key properties of ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate?
ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate has a molecular weight of 377.49 g/mol, XLogP of 2.94, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 1-[3-(1H-imidazol-5-yl)prop-2-enyl]pyrrolidine-2,2-dicarboxylate is sourced from PubChem (CID 54487124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).