C28H31N2O2+ — CID 54487367
anilinomethylidene-(4-carboxyphenyl)-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)azanium (PubChem CID 54487367) has the molecular formula C28H31N2O2+ and a molecular weight of 427.57 g/mol. Its IUPAC name is anilinomethylidene-(4-carboxyphenyl)-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)azanium.
| Compound Name | anilinomethylidene-(4-carboxyphenyl)-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)azanium |
|---|---|
| PubChem CID | 54487367 |
| Molecular Formula | C28H31N2O2+ |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | anilinomethylidene-(4-carboxyphenyl)-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)azanium |
| SMILES | CC1(C)CCC(C)(C)c2cc(/[N+](=C/Nc3ccccc3)c3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C28H30N2O2/c1-27(2)16-17-28(3,4)25-18-23(14-15-24(25)27)30(19-29-21-8-6-5-7-9-21)22-12-10-20(11-13-22)26(31)32/h5-15,18-19H,16-17H2,1-4H3,(H,31,32)/p+1 |
| InChIKey | UPTZAYZAJLALGF-UHFFFAOYSA-O |
| XLogP | 6.71 |
| TPSA | 52.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|