C21H35FN2O2S — CID 54487383
N-[4-[4-[ethyl-(6-fluoro-6-methylheptyl)amino]but-1-enyl]phenyl]methanesulfonamide (PubChem CID 54487383) has the molecular formula C21H35FN2O2S and a molecular weight of 398.59 g/mol. Its IUPAC name is N-[4-[4-[ethyl-(6-fluoro-6-methylheptyl)amino]but-1-enyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[4-[ethyl-(6-fluoro-6-methylheptyl)amino]but-1-enyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 54487383 |
| Molecular Formula | C21H35FN2O2S |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-[4-[4-[ethyl-(6-fluoro-6-methylheptyl)amino]but-1-enyl]phenyl]methanesulfonamide |
| SMILES | CCN(CCC=Cc1ccc(NS(C)(=O)=O)cc1)CCCCCC(C)(C)F |
| InChI | InChI=1S/C21H35FN2O2S/c1-5-24(17-9-6-8-16-21(2,3)22)18-10-7-11-19-12-14-20(15-13-19)23-27(4,25)26/h7,11-15,23H,5-6,8-10,16-18H2,1-4H3 |
| InChIKey | XTGVXVASMAODGL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|