C17H29NO2 — CID 54487794
8-hydroxy-N,N,6-trimethyl-2-(4-methylpent-3-enyl)octa-2,6-dienamide (PubChem CID 54487794) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 8-hydroxy-N,N,6-trimethyl-2-(4-methylpent-3-enyl)octa-2,6-dienamide.
| Compound Name | 8-hydroxy-N,N,6-trimethyl-2-(4-methylpent-3-enyl)octa-2,6-dienamide |
|---|---|
| PubChem CID | 54487794 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 8-hydroxy-N,N,6-trimethyl-2-(4-methylpent-3-enyl)octa-2,6-dienamide |
| SMILES | CC(C)=CCCC(=CCCC(C)=CCO)C(=O)N(C)C |
| InChI | InChI=1S/C17H29NO2/c1-14(2)8-6-10-16(17(20)18(4)5)11-7-9-15(3)12-13-19/h8,11-12,19H,6-7,9-10,13H2,1-5H3 |
| InChIKey | XTOPFLCVYMRSEC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|