About 4-(furan-2-yl)pyridazine
4-(furan-2-yl)pyridazine (PubChem CID 54487865) has the molecular formula C8H6N2O
and a molecular weight of 146.15 g/mol. Its IUPAC name is 4-(furan-2-yl)pyridazine.
Molecular Properties
| Compound Name | 4-(furan-2-yl)pyridazine |
| PubChem CID | 54487865 |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 4-(furan-2-yl)pyridazine |
| SMILES | c1coc(-c2ccnnc2)c1 |
| InChI | InChI=1S/C8H6N2O/c1-2-8(11-5-1)7-3-4-9-10-6-7/h1-6H |
| InChIKey | LUUCYPZLHMWXLA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(furan-2-yl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)pyridazine?
The IUPAC name of 4-(furan-2-yl)pyridazine (CID 54487865) is 4-(furan-2-yl)pyridazine.
What is the SMILES notation for 4-(furan-2-yl)pyridazine?
The canonical SMILES for 4-(furan-2-yl)pyridazine is c1coc(-c2ccnnc2)c1.
What is the InChIKey of 4-(furan-2-yl)pyridazine?
The InChIKey is LUUCYPZLHMWXLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O/c1-2-8(11-5-1)7-3-4-9-10-6-7/h1-6H.
What are the key properties of 4-(furan-2-yl)pyridazine?
4-(furan-2-yl)pyridazine has a molecular weight of 146.15 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)pyridazine is sourced from PubChem (CID 54487865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).