C17H18N4O5 — CID 54488219
N-[2-(dimethylamino)ethyl]-3,4-dinitro-N-phenylbenzamide (PubChem CID 54488219) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3,4-dinitro-N-phenylbenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3,4-dinitro-N-phenylbenzamide |
|---|---|
| PubChem CID | 54488219 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3,4-dinitro-N-phenylbenzamide |
| SMILES | CN(C)CCN(C(=O)c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C17H18N4O5/c1-18(2)10-11-19(14-6-4-3-5-7-14)17(22)13-8-9-15(20(23)24)16(12-13)21(25)26/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | XTWJGHSPMQZPAD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|