C10H11F7 — CID 54488488
3,4,5,6,6,7,7-heptafluoro-2-methylnona-2,4-diene (PubChem CID 54488488) has the molecular formula C10H11F7 and a molecular weight of 264.18 g/mol. Its IUPAC name is 3,4,5,6,6,7,7-heptafluoro-2-methylnona-2,4-diene.
| Compound Name | 3,4,5,6,6,7,7-heptafluoro-2-methylnona-2,4-diene |
|---|---|
| PubChem CID | 54488488 |
| Molecular Formula | C10H11F7 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3,4,5,6,6,7,7-heptafluoro-2-methylnona-2,4-diene |
| SMILES | CCC(F)(F)C(F)(F)C(F)=C(F)C(F)=C(C)C |
| InChI | InChI=1S/C10H11F7/c1-4-9(14,15)10(16,17)8(13)7(12)6(11)5(2)3/h4H2,1-3H3 |
| InChIKey | XUBFKJLUXQJJPC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|