C19H18FNO2 — CID 54488598
9-(3-fluorophenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione (PubChem CID 54488598) has the molecular formula C19H18FNO2 and a molecular weight of 311.36 g/mol. Its IUPAC name is 9-(3-fluorophenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione.
| Compound Name | 9-(3-fluorophenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 54488598 |
| Molecular Formula | C19H18FNO2 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 9-(3-fluorophenyl)-2,3,4,5,6,7,8a,9-octahydroacridine-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1cccc(F)c1)C1C(=O)CCCC1=N2 |
| InChI | InChI=1S/C19H18FNO2/c20-12-5-1-4-11(10-12)17-18-13(6-2-8-15(18)22)21-14-7-3-9-16(23)19(14)17/h1,4-5,10,17-18H,2-3,6-9H2 |
| InChIKey | XUDLIIWNXYDYPY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |