About but-3-yn-2-ylcyclohexane
but-3-yn-2-ylcyclohexane (PubChem CID 54488815) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is but-3-yn-2-ylcyclohexane.
Molecular Properties
| Compound Name | but-3-yn-2-ylcyclohexane |
| PubChem CID | 54488815 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | but-3-yn-2-ylcyclohexane |
| SMILES | C#CC(C)C1CCCCC1 |
| InChI | InChI=1S/C10H16/c1-3-9(2)10-7-5-4-6-8-10/h1,9-10H,4-8H2,2H3 |
| InChIKey | JIXMCUJGRXYFNF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-yn-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-yn-2-ylcyclohexane?
The IUPAC name of but-3-yn-2-ylcyclohexane (CID 54488815) is but-3-yn-2-ylcyclohexane.
What is the SMILES notation for but-3-yn-2-ylcyclohexane?
The canonical SMILES for but-3-yn-2-ylcyclohexane is C#CC(C)C1CCCCC1.
What is the InChIKey of but-3-yn-2-ylcyclohexane?
The InChIKey is JIXMCUJGRXYFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-3-9(2)10-7-5-4-6-8-10/h1,9-10H,4-8H2,2H3.
What are the key properties of but-3-yn-2-ylcyclohexane?
but-3-yn-2-ylcyclohexane has a molecular weight of 136.24 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-yn-2-ylcyclohexane is sourced from PubChem (CID 54488815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).