C24H36O4S — CID 54489008
ethyl 7-(benzenesulfonyl)-7-(2,6,6-trimethylcyclohexen-1-yl)heptanoate (PubChem CID 54489008) has the molecular formula C24H36O4S and a molecular weight of 420.62 g/mol. Its IUPAC name is ethyl 7-(benzenesulfonyl)-7-(2,6,6-trimethylcyclohexen-1-yl)heptanoate.
| Compound Name | ethyl 7-(benzenesulfonyl)-7-(2,6,6-trimethylcyclohexen-1-yl)heptanoate |
|---|---|
| PubChem CID | 54489008 |
| Molecular Formula | C24H36O4S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | ethyl 7-(benzenesulfonyl)-7-(2,6,6-trimethylcyclohexen-1-yl)heptanoate |
| SMILES | CCOC(=O)CCCCCC(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H36O4S/c1-5-28-22(25)17-11-7-10-16-21(23-19(2)13-12-18-24(23,3)4)29(26,27)20-14-8-6-9-15-20/h6,8-9,14-15,21H,5,7,10-13,16-18H2,1-4H3 |
| InChIKey | XUKLHRAVWKLEQT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|