C24H36O7 — CID 54489214
[(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] octadeca-6,9,12-trienoate (PubChem CID 54489214) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] octadeca-6,9,12-trienoate.
| Compound Name | [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 54489214 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] octadeca-6,9,12-trienoate |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(=O)OC[C@H](O)[C@H]1OC(=O)C(O)C1=O |
| InChI | InChI=1S/C24H36O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(26)30-18-19(25)23-21(27)22(28)24(29)31-23/h6-7,9-10,12-13,19,22-23,25,28H,2-5,8,11,14-18H2,1H3/t19-,22?,23+/m0/s1 |
| InChIKey | XUNOOLRFHNVOSO-IQWVOLIVSA-N |
| XLogP | 3.34 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|