C24H27NO4 — CID 5449000
8-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-7-hydroxy-3-(2-methoxyphenyl)chromen-4-one (PubChem CID 5449000) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 8-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-7-hydroxy-3-(2-methoxyphenyl)chromen-4-one.
| Compound Name | 8-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-7-hydroxy-3-(2-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 5449000 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 8-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-7-hydroxy-3-(2-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccccc1-c1coc2c(CN3[C@H](C)CCC[C@@H]3C)c(O)ccc2c1=O |
| InChI | InChI=1S/C24H27NO4/c1-15-7-6-8-16(2)25(15)13-19-21(26)12-11-18-23(27)20(14-29-24(18)19)17-9-4-5-10-22(17)28-3/h4-5,9-12,14-16,26H,6-8,13H2,1-3H3/t15-,16+ |
| InChIKey | HITBXRASXIBMQP-IYBDPMFKSA-N |
| XLogP | 4.94 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|