C32H34O5 — CID 54490707
(4R)-4-methyl-16,18-bis(phenylmethoxy)-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,8-dione (PubChem CID 54490707) has the molecular formula C32H34O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is (4R)-4-methyl-16,18-bis(phenylmethoxy)-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,8-dione.
| Compound Name | (4R)-4-methyl-16,18-bis(phenylmethoxy)-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,8-dione |
|---|---|
| PubChem CID | 54490707 |
| Molecular Formula | C32H34O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (4R)-4-methyl-16,18-bis(phenylmethoxy)-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,8-dione |
| SMILES | C[C@@H]1CCCC(=O)CCCC=Cc2cc(OCc3ccccc3)cc(OCc3ccccc3)c2C(=O)O1 |
| InChI | InChI=1S/C32H34O5/c1-24-12-11-19-28(33)18-10-4-9-17-27-20-29(35-22-25-13-5-2-6-14-25)21-30(31(27)32(34)37-24)36-23-26-15-7-3-8-16-26/h2-3,5-9,13-17,20-21,24H,4,10-12,18-19,22-23H2,1H3/t24-/m1/s1 |
| InChIKey | XVMZYHUTEMOREA-XMMPIXPASA-N |
| XLogP | 7.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |