C22H20F2N4O4 — CID 54490782
9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-(tetrazol-1-yl)nona-6,8-dienoic acid (PubChem CID 54490782) has the molecular formula C22H20F2N4O4 and a molecular weight of 442.42 g/mol. Its IUPAC name is 9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-(tetrazol-1-yl)nona-6,8-dienoic acid.
| Compound Name | 9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-(tetrazol-1-yl)nona-6,8-dienoic acid |
|---|---|
| PubChem CID | 54490782 |
| Molecular Formula | C22H20F2N4O4 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-(tetrazol-1-yl)nona-6,8-dienoic acid |
| SMILES | O=C(O)CC(O)CC(O)C=CC(=C(c1ccc(F)cc1)c1ccc(F)cc1)n1cnnn1 |
| InChI | InChI=1S/C22H20F2N4O4/c23-16-5-1-14(2-6-16)22(15-3-7-17(24)8-4-15)20(28-13-25-26-27-28)10-9-18(29)11-19(30)12-21(31)32/h1-10,13,18-19,29-30H,11-12H2,(H,31,32) |
| InChIKey | XVOGPTRLJJHROM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|