C25H32O2 — CID 54490926
3-methyl-6-(5,5,8,8-tetramethyl-3,4,6,7-tetrahydroanthracen-1-yl)hexa-2,4-dienoic acid (PubChem CID 54490926) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is 3-methyl-6-(5,5,8,8-tetramethyl-3,4,6,7-tetrahydroanthracen-1-yl)hexa-2,4-dienoic acid.
| Compound Name | 3-methyl-6-(5,5,8,8-tetramethyl-3,4,6,7-tetrahydroanthracen-1-yl)hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 54490926 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 3-methyl-6-(5,5,8,8-tetramethyl-3,4,6,7-tetrahydroanthracen-1-yl)hexa-2,4-dienoic acid |
| SMILES | CC(C=CCC1=CCCc2cc3c(cc21)C(C)(C)CCC3(C)C)=CC(=O)O |
| InChI | InChI=1S/C25H32O2/c1-17(14-23(26)27)8-6-9-18-10-7-11-19-15-21-22(16-20(18)19)25(4,5)13-12-24(21,2)3/h6,8,10,14-16H,7,9,11-13H2,1-5H3,(H,26,27) |
| InChIKey | XVQXVGIUQJPRCN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|