About ethane;trimethoxy(3,3,3-trifluoropropyl)silane
ethane;trimethoxy(3,3,3-trifluoropropyl)silane (PubChem CID 54491080) has the molecular formula C8H19F3O3Si
and a molecular weight of 248.32 g/mol. Its IUPAC name is ethane;trimethoxy(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | ethane;trimethoxy(3,3,3-trifluoropropyl)silane |
| PubChem CID | 54491080 |
| Molecular Formula | C8H19F3O3Si |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | ethane;trimethoxy(3,3,3-trifluoropropyl)silane |
| SMILES | CC.CO[Si](CCC(F)(F)F)(OC)OC |
| InChI | InChI=1S/C6H13F3O3Si.C2H6/c1-10-13(11-2,12-3)5-4-6(7,8)9;1-2/h4-5H2,1-3H3;1-2H3 |
| InChIKey | XVTSOXMERPVEPK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane;trimethoxy(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;trimethoxy(3,3,3-trifluoropropyl)silane?
The IUPAC name of ethane;trimethoxy(3,3,3-trifluoropropyl)silane (CID 54491080) is ethane;trimethoxy(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for ethane;trimethoxy(3,3,3-trifluoropropyl)silane?
The canonical SMILES for ethane;trimethoxy(3,3,3-trifluoropropyl)silane is CC.CO[Si](CCC(F)(F)F)(OC)OC.
What is the InChIKey of ethane;trimethoxy(3,3,3-trifluoropropyl)silane?
The InChIKey is XVTSOXMERPVEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3O3Si.C2H6/c1-10-13(11-2,12-3)5-4-6(7,8)9;1-2/h4-5H2,1-3H3;1-2H3.
What are the key properties of ethane;trimethoxy(3,3,3-trifluoropropyl)silane?
ethane;trimethoxy(3,3,3-trifluoropropyl)silane has a molecular weight of 248.32 g/mol, XLogP of 2.84, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;trimethoxy(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 54491080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).