C18H21NO7S — CID 54491493
(2S,5R,6R)-6-(acetyloxymethyl)-2-benzyl-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 54491493) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is (2S,5R,6R)-6-(acetyloxymethyl)-2-benzyl-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-(acetyloxymethyl)-2-benzyl-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 54491493 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2S,5R,6R)-6-(acetyloxymethyl)-2-benzyl-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC(=O)OC[C@@H]1C(=O)N2[C@@H]1S(=O)(=O)C(C)(C)[C@]2(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H21NO7S/c1-11(20)26-10-13-14(21)19-15(13)27(24,25)17(2,3)18(19,16(22)23)9-12-7-5-4-6-8-12/h4-8,13,15H,9-10H2,1-3H3,(H,22,23)/t13-,15-,18+/m1/s1 |
| InChIKey | XWAUHXTUMJJZKZ-SIIHOXLZSA-N |
| XLogP | 0.61 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |